C21H24N4O2 — CID 112892967
4-N-benzyl-2-N-(2,5-dimethoxyphenyl)-4-N-ethylpyrimidine-2,4-diamine (PubChem CID 112892967) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-N-benzyl-2-N-(2,5-dimethoxyphenyl)-4-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-(2,5-dimethoxyphenyl)-4-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112892967 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-N-benzyl-2-N-(2,5-dimethoxyphenyl)-4-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCN(Cc1ccccc1)c1ccnc(Nc2cc(OC)ccc2OC)n1 |
| InChI | InChI=1S/C21H24N4O2/c1-4-25(15-16-8-6-5-7-9-16)20-12-13-22-21(24-20)23-18-14-17(26-2)10-11-19(18)27-3/h5-14H,4,15H2,1-3H3,(H,22,23,24) |
| InChIKey | BGQLHROQGVKGDI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |