C19H18Cl2N4 — CID 112892999
4-N-benzyl-2-N-(3,4-dichlorophenyl)-4-N-ethylpyrimidine-2,4-diamine (PubChem CID 112892999) has the molecular formula C19H18Cl2N4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 4-N-benzyl-2-N-(3,4-dichlorophenyl)-4-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-(3,4-dichlorophenyl)-4-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112892999 |
| Molecular Formula | C19H18Cl2N4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-N-benzyl-2-N-(3,4-dichlorophenyl)-4-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCN(Cc1ccccc1)c1ccnc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H18Cl2N4/c1-2-25(13-14-6-4-3-5-7-14)18-10-11-22-19(24-18)23-15-8-9-16(20)17(21)12-15/h3-12H,2,13H2,1H3,(H,22,23,24) |
| InChIKey | LOYMLQFWVJKMSF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |