C15H26N2O4 — CID 11289519
(2S,3R,4S)-N-tert-butyl-1-hex-5-enoyl-3,4-dihydroxypyrrolidine-2-carboxamide (PubChem CID 11289519) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S,3R,4S)-N-tert-butyl-1-hex-5-enoyl-3,4-dihydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S)-N-tert-butyl-1-hex-5-enoyl-3,4-dihydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11289519 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S,3R,4S)-N-tert-butyl-1-hex-5-enoyl-3,4-dihydroxypyrrolidine-2-carboxamide |
| SMILES | C=CCCCC(=O)N1C[C@H](O)[C@H](O)[C@H]1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-5-6-7-8-11(19)17-9-10(18)13(20)12(17)14(21)16-15(2,3)4/h5,10,12-13,18,20H,1,6-9H2,2-4H3,(H,16,21)/t10-,12-,13-/m0/s1 |
| InChIKey | SKZGNOPUVFLVHY-DRZSPHRISA-N |
| XLogP | 0.19 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|