C18H25N5 — CID 112896475
N,N-diethyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112896475) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is N,N-diethyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N,N-diethyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112896475 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N,N-diethyl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CCN(CC)c1ccnc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C18H25N5/c1-3-21(4-2)17-10-11-19-18(20-17)23-14-12-22(13-15-23)16-8-6-5-7-9-16/h5-11H,3-4,12-15H2,1-2H3 |
| InChIKey | LLDTZRVCGBINTD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |