C22H25N5O2 — CID 112896527
N-(3,4-dimethoxyphenyl)-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112896527) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112896527 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ccnc(N3CCN(c4ccccc4)CC3)n2)cc1OC |
| InChI | InChI=1S/C22H25N5O2/c1-28-19-9-8-17(16-20(19)29-2)24-21-10-11-23-22(25-21)27-14-12-26(13-15-27)18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3,(H,23,24,25) |
| InChIKey | ILSXLNURSWDKNJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |