C20H21ClN4O — CID 112897086
4-N-[2-(4-chlorophenyl)ethyl]-2-N-(2-ethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112897086) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 4-N-[2-(4-chlorophenyl)ethyl]-2-N-(2-ethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(4-chlorophenyl)ethyl]-2-N-(2-ethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112897086 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-N-[2-(4-chlorophenyl)ethyl]-2-N-(2-ethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCOc1ccccc1Nc1nccc(NCCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H21ClN4O/c1-2-26-18-6-4-3-5-17(18)24-20-23-14-12-19(25-20)22-13-11-15-7-9-16(21)10-8-15/h3-10,12,14H,2,11,13H2,1H3,(H2,22,23,24,25) |
| InChIKey | QLZRCIWOLQYDIC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |