C17H23NO4 — CID 11289718
pyridin-2-ylmethyl (E)-2-[2-(oxan-2-yloxy)ethyl]but-2-enoate (PubChem CID 11289718) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is pyridin-2-ylmethyl (E)-2-[2-(oxan-2-yloxy)ethyl]but-2-enoate.
| Compound Name | pyridin-2-ylmethyl (E)-2-[2-(oxan-2-yloxy)ethyl]but-2-enoate |
|---|---|
| PubChem CID | 11289718 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | pyridin-2-ylmethyl (E)-2-[2-(oxan-2-yloxy)ethyl]but-2-enoate |
| SMILES | C/C=C(\CCOC1CCCCO1)C(=O)OCc1ccccn1 |
| InChI | InChI=1S/C17H23NO4/c1-2-14(9-12-21-16-8-4-6-11-20-16)17(19)22-13-15-7-3-5-10-18-15/h2-3,5,7,10,16H,4,6,8-9,11-13H2,1H3/b14-2+ |
| InChIKey | FMZALDHVEMMPKL-JLZUIIAYSA-N |
| XLogP | 3.00 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|