C14H17NO6 — CID 19075919
2-(oxan-2-yloxy)-2-(pyridin-2-ylmethyl)propanedioic acid (PubChem CID 19075919) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)-2-(pyridin-2-ylmethyl)propanedioic acid.
| Compound Name | 2-(oxan-2-yloxy)-2-(pyridin-2-ylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 19075919 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(oxan-2-yloxy)-2-(pyridin-2-ylmethyl)propanedioic acid |
| SMILES | O=C(O)C(Cc1ccccn1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C14H17NO6/c16-12(17)14(13(18)19,9-10-5-1-3-7-15-10)21-11-6-2-4-8-20-11/h1,3,5,7,11H,2,4,6,8-9H2,(H,16,17)(H,18,19) |
| InChIKey | LQKASELOWOQFOL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|