C16H20O7S — CID 19075879
2-[(4-methoxyphenyl)sulfanylmethyl]-2-(oxan-2-yloxy)propanedioic acid (PubChem CID 19075879) has the molecular formula C16H20O7S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfanylmethyl]-2-(oxan-2-yloxy)propanedioic acid.
| Compound Name | 2-[(4-methoxyphenyl)sulfanylmethyl]-2-(oxan-2-yloxy)propanedioic acid |
|---|---|
| PubChem CID | 19075879 |
| Molecular Formula | C16H20O7S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfanylmethyl]-2-(oxan-2-yloxy)propanedioic acid |
| SMILES | COc1ccc(SCC(OC2CCCCO2)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H20O7S/c1-21-11-5-7-12(8-6-11)24-10-16(14(17)18,15(19)20)23-13-4-2-3-9-22-13/h5-8,13H,2-4,9-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JAABYDYJJCEJEF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|