C13H23BrO3 — CID 11289768
ethyl (5S)-5-bromo-5-[(1R,2R,5R)-2-hydroxy-5-methylcyclopentyl]pentanoate (PubChem CID 11289768) has the molecular formula C13H23BrO3 and a molecular weight of 307.23 g/mol. Its IUPAC name is ethyl (5S)-5-bromo-5-[(1R,2R,5R)-2-hydroxy-5-methylcyclopentyl]pentanoate.
| Compound Name | ethyl (5S)-5-bromo-5-[(1R,2R,5R)-2-hydroxy-5-methylcyclopentyl]pentanoate |
|---|---|
| PubChem CID | 11289768 |
| Molecular Formula | C13H23BrO3 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | ethyl (5S)-5-bromo-5-[(1R,2R,5R)-2-hydroxy-5-methylcyclopentyl]pentanoate |
| SMILES | CCOC(=O)CCC[C@H](Br)[C@@H]1[C@H](C)CC[C@H]1O |
| InChI | InChI=1S/C13H23BrO3/c1-3-17-12(16)6-4-5-10(14)13-9(2)7-8-11(13)15/h9-11,13,15H,3-8H2,1-2H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | XPRJPSVSZGIJOS-XZUYRWCXSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|