C23H26FN5 — CID 112898489
N-ethyl-4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methylphenyl)pyrimidin-2-amine (PubChem CID 112898489) has the molecular formula C23H26FN5 and a molecular weight of 391.49 g/mol. Its IUPAC name is N-ethyl-4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methylphenyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112898489 |
| Molecular Formula | C23H26FN5 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | N-ethyl-4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methylphenyl)pyrimidin-2-amine |
| SMILES | CCN(c1cccc(C)c1)c1nccc(N2CCN(c3ccccc3F)CC2)n1 |
| InChI | InChI=1S/C23H26FN5/c1-3-29(19-8-6-7-18(2)17-19)23-25-12-11-22(26-23)28-15-13-27(14-16-28)21-10-5-4-9-20(21)24/h4-12,17H,3,13-16H2,1-2H3 |
| InChIKey | GHVJJTRBGQYJFW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |