C20H29N5 — CID 112914294
N-ethyl-4-(4-ethylpiperazin-1-yl)-6-methyl-N-(3-methylphenyl)pyrimidin-2-amine (PubChem CID 112914294) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is N-ethyl-4-(4-ethylpiperazin-1-yl)-6-methyl-N-(3-methylphenyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-4-(4-ethylpiperazin-1-yl)-6-methyl-N-(3-methylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112914294 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-ethyl-4-(4-ethylpiperazin-1-yl)-6-methyl-N-(3-methylphenyl)pyrimidin-2-amine |
| SMILES | CCN1CCN(c2cc(C)nc(N(CC)c3cccc(C)c3)n2)CC1 |
| InChI | InChI=1S/C20H29N5/c1-5-23-10-12-24(13-11-23)19-15-17(4)21-20(22-19)25(6-2)18-9-7-8-16(3)14-18/h7-9,14-15H,5-6,10-13H2,1-4H3 |
| InChIKey | HEQOFMSHYQUMNI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |