C18H20ClF3N4 — CID 112900889
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(2-ethylpiperidin-1-yl)pyrimidin-2-amine (PubChem CID 112900889) has the molecular formula C18H20ClF3N4 and a molecular weight of 384.83 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(2-ethylpiperidin-1-yl)pyrimidin-2-amine.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(2-ethylpiperidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112900889 |
| Molecular Formula | C18H20ClF3N4 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(2-ethylpiperidin-1-yl)pyrimidin-2-amine |
| SMILES | CCC1CCCCN1c1ccnc(Nc2cc(C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C18H20ClF3N4/c1-2-13-5-3-4-10-26(13)16-8-9-23-17(25-16)24-15-11-12(18(20,21)22)6-7-14(15)19/h6-9,11,13H,2-5,10H2,1H3,(H,23,24,25) |
| InChIKey | VQPKTTUTYPTCMB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |