C22H22N6O — CID 112901710
2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 112901710) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112901710 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | COc1ccc(N2CCN(c3ccnc(Nc4ccccc4C#N)n3)CC2)cc1 |
| InChI | InChI=1S/C22H22N6O/c1-29-19-8-6-18(7-9-19)27-12-14-28(15-13-27)21-10-11-24-22(26-21)25-20-5-3-2-4-17(20)16-23/h2-11H,12-15H2,1H3,(H,24,25,26) |
| InChIKey | NFCKOZJKJUEYNH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|