C21H21F2N5O — CID 112901714
N-(3,4-difluorophenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine (PubChem CID 112901714) has the molecular formula C21H21F2N5O and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | N-(3,4-difluorophenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112901714 |
| Molecular Formula | C21H21F2N5O |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-2-amine |
| SMILES | COc1ccc(N2CCN(c3ccnc(Nc4ccc(F)c(F)c4)n3)CC2)cc1 |
| InChI | InChI=1S/C21H21F2N5O/c1-29-17-5-3-16(4-6-17)27-10-12-28(13-11-27)20-8-9-24-21(26-20)25-15-2-7-18(22)19(23)14-15/h2-9,14H,10-13H2,1H3,(H,24,25,26) |
| InChIKey | RGDRXKPWDVRLBZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|