C19H16F3N5O — CID 112905487
N-[4-[[2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 112905487) has the molecular formula C19H16F3N5O and a molecular weight of 387.37 g/mol. Its IUPAC name is N-[4-[[2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112905487 |
| Molecular Formula | C19H16F3N5O |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[4-[[2-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccnc(Nc3ccccc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H16F3N5O/c1-12(28)24-13-6-8-14(9-7-13)25-17-10-11-23-18(27-17)26-16-5-3-2-4-15(16)19(20,21)22/h2-11H,1H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | SCTLIBCXGASTQZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |