C18H15F2N5O — CID 112905840
N-[4-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 112905840) has the molecular formula C18H15F2N5O and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[4-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112905840 |
| Molecular Formula | C18H15F2N5O |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[4-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nccc(Nc3c(F)cccc3F)n2)cc1 |
| InChI | InChI=1S/C18H15F2N5O/c1-11(26)22-12-5-7-13(8-6-12)23-18-21-10-9-16(25-18)24-17-14(19)3-2-4-15(17)20/h2-10H,1H3,(H,22,26)(H2,21,23,24,25) |
| InChIKey | JPMOBXGCXKHMMJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |