C16H15N7O — CID 117094486
N-[4-[[2-(pyrazin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 117094486) has the molecular formula C16H15N7O and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[4-[[2-(pyrazin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-(pyrazin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117094486 |
| Molecular Formula | C16H15N7O |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[4-[[2-(pyrazin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccnc(Nc3cnccn3)n2)cc1 |
| InChI | InChI=1S/C16H15N7O/c1-11(24)20-12-2-4-13(5-3-12)21-14-6-7-19-16(22-14)23-15-10-17-8-9-18-15/h2-10H,1H3,(H,20,24)(H2,18,19,21,22,23) |
| InChIKey | DBIGQARRQIOUQE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |