C18H17Cl2N5 — CID 112906065
2-N-(2,3-dichlorophenyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine (PubChem CID 112906065) has the molecular formula C18H17Cl2N5 and a molecular weight of 374.28 g/mol. Its IUPAC name is 2-N-(2,3-dichlorophenyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,3-dichlorophenyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112906065 |
| Molecular Formula | C18H17Cl2N5 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-N-(2,3-dichlorophenyl)-4-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1ccc(Nc2ccnc(Nc3cccc(Cl)c3Cl)n2)cc1 |
| InChI | InChI=1S/C18H17Cl2N5/c1-25(2)13-8-6-12(7-9-13)22-16-10-11-21-18(24-16)23-15-5-3-4-14(19)17(15)20/h3-11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | LYRMUWQNCICBKO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|