C15H29NO3S2 — CID 11290617
tert-butyl (4S)-4-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11290617) has the molecular formula C15H29NO3S2 and a molecular weight of 335.54 g/mol. Its IUPAC name is tert-butyl (4S)-4-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11290617 |
| Molecular Formula | C15H29NO3S2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | tert-butyl (4S)-4-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCSC(SCC)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO3S2/c1-8-20-12(21-9-2)11-10-18-15(6,7)16(11)13(17)19-14(3,4)5/h11-12H,8-10H2,1-7H3/t11-/m0/s1 |
| InChIKey | CLANYUPPUMEOAC-NSHDSACASA-N |
| XLogP | 4.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|