C12H23NO3S — CID 91014293
tert-butyl 2,2-dimethyl-4-(2-sulfanylethyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 91014293) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-(2-sulfanylethyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-(2-sulfanylethyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 91014293 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-(2-sulfanylethyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CCS)COC1(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-11(2,3)16-10(14)13-9(6-7-17)8-15-12(13,4)5/h9,17H,6-8H2,1-5H3 |
| InChIKey | NRMIUOFGCCYBOT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|