C18H23N3O4 — CID 11290915
methyl 2-[(2-methoxy-2-oxoethyl)-[2-(5-methyl-3-phenylpyrazol-1-yl)ethyl]amino]acetate (PubChem CID 11290915) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-[2-(5-methyl-3-phenylpyrazol-1-yl)ethyl]amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-[2-(5-methyl-3-phenylpyrazol-1-yl)ethyl]amino]acetate |
|---|---|
| PubChem CID | 11290915 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-[2-(5-methyl-3-phenylpyrazol-1-yl)ethyl]amino]acetate |
| SMILES | COC(=O)CN(CCn1nc(-c2ccccc2)cc1C)CC(=O)OC |
| InChI | InChI=1S/C18H23N3O4/c1-14-11-16(15-7-5-4-6-8-15)19-21(14)10-9-20(12-17(22)24-2)13-18(23)25-3/h4-8,11H,9-10,12-13H2,1-3H3 |
| InChIKey | CXLOJHPVRQJNPE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |