C35H33N3O4 — CID 70229713
methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenylpyrazol-1-yl)ethoxy]phenyl]propanoate (PubChem CID 70229713) has the molecular formula C35H33N3O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenylpyrazol-1-yl)ethoxy]phenyl]propanoate.
| Compound Name | methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenylpyrazol-1-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 70229713 |
| Molecular Formula | C35H33N3O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenylpyrazol-1-yl)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)CC(Nc1ccccc1C(=O)c1ccccc1)c1ccc(OCCn2nc(-c3ccccc3)cc2C)cc1 |
| InChI | InChI=1S/C35H33N3O4/c1-25-23-33(26-11-5-3-6-12-26)37-38(25)21-22-42-29-19-17-27(18-20-29)32(24-34(39)41-2)36-31-16-10-9-15-30(31)35(40)28-13-7-4-8-14-28/h3-20,23,32,36H,21-22,24H2,1-2H3 |
| InChIKey | DPFKBUVAEULNKX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|