C36H35N3O5 — CID 67534295
3-(2-benzoylanilino)-3-[4-[2-[3-(methoxymethyl)-5-methyl-2-phenylimidazol-4-yl]ethoxy]phenyl]propanoic acid (PubChem CID 67534295) has the molecular formula C36H35N3O5 and a molecular weight of 589.69 g/mol. Its IUPAC name is 3-(2-benzoylanilino)-3-[4-[2-[3-(methoxymethyl)-5-methyl-2-phenylimidazol-4-yl]ethoxy]phenyl]propanoic acid.
| Compound Name | 3-(2-benzoylanilino)-3-[4-[2-[3-(methoxymethyl)-5-methyl-2-phenylimidazol-4-yl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67534295 |
| Molecular Formula | C36H35N3O5 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 3-(2-benzoylanilino)-3-[4-[2-[3-(methoxymethyl)-5-methyl-2-phenylimidazol-4-yl]ethoxy]phenyl]propanoic acid |
| SMILES | COCn1c(-c2ccccc2)nc(C)c1CCOc1ccc(C(CC(=O)O)Nc2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35N3O5/c1-25-33(39(24-43-2)36(37-25)28-13-7-4-8-14-28)21-22-44-29-19-17-26(18-20-29)32(23-34(40)41)38-31-16-10-9-15-30(31)35(42)27-11-5-3-6-12-27/h3-20,32,38H,21-24H2,1-2H3,(H,40,41) |
| InChIKey | NXWMIXAOPOKZJT-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|