C34H32N4O4 — CID 70227454
methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)ethoxy]phenyl]propanoate (PubChem CID 70227454) has the molecular formula C34H32N4O4 and a molecular weight of 560.65 g/mol. Its IUPAC name is methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)ethoxy]phenyl]propanoate.
| Compound Name | methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 70227454 |
| Molecular Formula | C34H32N4O4 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | methyl 3-(2-benzoylanilino)-3-[4-[2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)CC(Nc1ccccc1C(=O)c1ccccc1)c1ccc(OCCn2nc(-c3ccccc3)nc2C)cc1 |
| InChI | InChI=1S/C34H32N4O4/c1-24-35-34(27-13-7-4-8-14-27)37-38(24)21-22-42-28-19-17-25(18-20-28)31(23-32(39)41-2)36-30-16-10-9-15-29(30)33(40)26-11-5-3-6-12-26/h3-20,31,36H,21-23H2,1-2H3 |
| InChIKey | ZYAQMYGPBYTJEX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|