C39H34N2O4 — CID 10121358
methyl (2S)-3-[4-(2-benzo[b][1]benzazepin-11-ylethoxy)phenyl]-2-(2-benzoylanilino)propanoate (PubChem CID 10121358) has the molecular formula C39H34N2O4 and a molecular weight of 594.71 g/mol. Its IUPAC name is methyl (2S)-3-[4-(2-benzo[b][1]benzazepin-11-ylethoxy)phenyl]-2-(2-benzoylanilino)propanoate.
| Compound Name | methyl (2S)-3-[4-(2-benzo[b][1]benzazepin-11-ylethoxy)phenyl]-2-(2-benzoylanilino)propanoate |
|---|---|
| PubChem CID | 10121358 |
| Molecular Formula | C39H34N2O4 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | methyl (2S)-3-[4-(2-benzo[b][1]benzazepin-11-ylethoxy)phenyl]-2-(2-benzoylanilino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCN2c3ccccc3C=Cc3ccccc32)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C39H34N2O4/c1-44-39(43)35(40-34-16-8-7-15-33(34)38(42)31-13-3-2-4-14-31)27-28-19-23-32(24-20-28)45-26-25-41-36-17-9-5-11-29(36)21-22-30-12-6-10-18-37(30)41/h2-24,35,40H,25-27H2,1H3/t35-/m0/s1 |
| InChIKey | GDNPOIAIEPHBJJ-DHUJRADRSA-N |
| XLogP | 7.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|