C21H30N4 — CID 112910397
2-N-benzyl-4-N-cyclohexyl-6-methyl-2-N-propan-2-ylpyrimidine-2,4-diamine (PubChem CID 112910397) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-N-benzyl-4-N-cyclohexyl-6-methyl-2-N-propan-2-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-cyclohexyl-6-methyl-2-N-propan-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112910397 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-N-benzyl-4-N-cyclohexyl-6-methyl-2-N-propan-2-ylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC2CCCCC2)nc(N(Cc2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C21H30N4/c1-16(2)25(15-18-10-6-4-7-11-18)21-22-17(3)14-20(24-21)23-19-12-8-5-9-13-19/h4,6-7,10-11,14,16,19H,5,8-9,12-13,15H2,1-3H3,(H,22,23,24) |
| InChIKey | CFDRAIICPLCLKE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |