C15H24N4O3 — CID 112911551
4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)-6-methylpyrimidin-2-amine (PubChem CID 112911551) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112911551 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)-6-methylpyrimidin-2-amine |
| SMILES | COCCNc1nc(C)cc(N2CCC3(CC2)OCCO3)n1 |
| InChI | InChI=1S/C15H24N4O3/c1-12-11-13(18-14(17-12)16-5-8-20-2)19-6-3-15(4-7-19)21-9-10-22-15/h11H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | RBOPGHNXAFSIKS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|