C14H22N4O3 — CID 112856693
6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)pyrimidin-4-amine (PubChem CID 112856693) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)pyrimidin-4-amine.
| Compound Name | 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112856693 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(2-methoxyethyl)pyrimidin-4-amine |
| SMILES | COCCNc1cc(N2CCC3(CC2)OCCO3)ncn1 |
| InChI | InChI=1S/C14H22N4O3/c1-19-7-4-15-12-10-13(17-11-16-12)18-5-2-14(3-6-18)20-8-9-21-14/h10-11H,2-9H2,1H3,(H,15,16,17) |
| InChIKey | UNNTXAYHOXMTDH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|