C21H24N4O2 — CID 112911654
2-N-(2-methoxyethyl)-6-methyl-4-N-(4-phenylmethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112911654) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-6-methyl-4-N-(4-phenylmethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-6-methyl-4-N-(4-phenylmethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112911654 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-N-(2-methoxyethyl)-6-methyl-4-N-(4-phenylmethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(C)cc(Nc2ccc(OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C21H24N4O2/c1-16-14-20(25-21(23-16)22-12-13-26-2)24-18-8-10-19(11-9-18)27-15-17-6-4-3-5-7-17/h3-11,14H,12-13,15H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | VCLMNLZQEMWPIX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|