C20H21NO5 — CID 11291211
(6-ethoxy-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 11291211) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (6-ethoxy-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (6-ethoxy-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11291211 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (6-ethoxy-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | CCOc1ccc2c(C(=O)c3cc(OC)c(OC)c(OC)c3)c[nH]c2c1 |
| InChI | InChI=1S/C20H21NO5/c1-5-26-13-6-7-14-15(11-21-16(14)10-13)19(22)12-8-17(23-2)20(25-4)18(9-12)24-3/h6-11,21H,5H2,1-4H3 |
| InChIKey | YFRRRINCSDAZIR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |