C18H24FN5 — CID 112913799
N-[2-(4-fluorophenyl)ethyl]-4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112913799) has the molecular formula C18H24FN5 and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112913799 |
| Molecular Formula | C18H24FN5 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCN(C)CC2)nc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H24FN5/c1-14-13-17(24-11-9-23(2)10-12-24)22-18(21-14)20-8-7-15-3-5-16(19)6-4-15/h3-6,13H,7-12H2,1-2H3,(H,20,21,22) |
| InChIKey | ZIZHLCSQWJBAOO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |