C15H27N5 — CID 112913833
4-methyl-N-(3-methylbutyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112913833) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 4-methyl-N-(3-methylbutyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | 4-methyl-N-(3-methylbutyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112913833 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 4-methyl-N-(3-methylbutyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCN(C)CC2)nc(NCCC(C)C)n1 |
| InChI | InChI=1S/C15H27N5/c1-12(2)5-6-16-15-17-13(3)11-14(18-15)20-9-7-19(4)8-10-20/h11-12H,5-10H2,1-4H3,(H,16,17,18) |
| InChIKey | CYXGLOPEKFXQDE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |