C18H21Cl2N5O — CID 112914534
4-[2-[2-(2,4-dichlorophenyl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112914534) has the molecular formula C18H21Cl2N5O and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112914534 |
| Molecular Formula | C18H21Cl2N5O |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-[2-[2-(2,4-dichlorophenyl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(N2CCN(C=O)CC2)nc(NCCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H21Cl2N5O/c1-13-10-17(25-8-6-24(12-26)7-9-25)23-18(22-13)21-5-4-14-2-3-15(19)11-16(14)20/h2-3,10-12H,4-9H2,1H3,(H,21,22,23) |
| InChIKey | LIRQWSOPCFKLFI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|