C19H19BrN4 — CID 112917161
2-N-benzyl-4-N-(3-bromophenyl)-2-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 112917161) has the molecular formula C19H19BrN4 and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-N-benzyl-4-N-(3-bromophenyl)-2-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-(3-bromophenyl)-2-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112917161 |
| Molecular Formula | C19H19BrN4 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-N-benzyl-4-N-(3-bromophenyl)-2-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2cccc(Br)c2)nc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H19BrN4/c1-14-11-18(22-17-10-6-9-16(20)12-17)23-19(21-14)24(2)13-15-7-4-3-5-8-15/h3-12H,13H2,1-2H3,(H,21,22,23) |
| InChIKey | WLXZCCDKDAKGMW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |