C20H28N4O2S — CID 112923037
4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-6-methyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 112923037) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-6-methyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-6-methyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112923037 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-6-methyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | CCN(c1cc(C)nc(NCCCc2ccccc2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H28N4O2S/c1-3-24(18-11-13-27(25,26)15-18)19-14-16(2)22-20(23-19)21-12-7-10-17-8-5-4-6-9-17/h4-6,8-9,14,18H,3,7,10-13,15H2,1-2H3,(H,21,22,23) |
| InChIKey | ZQKGIXQWKGNCMJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|