C19H26N4O2S — CID 112897567
4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 112897567) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112897567 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | CCN(c1ccnc(NCCCc2ccccc2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H26N4O2S/c1-2-23(17-11-14-26(24,25)15-17)18-10-13-21-19(22-18)20-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10,13,17H,2,6,9,11-12,14-15H2,1H3,(H,20,21,22) |
| InChIKey | ZGQSVMASEQKRTB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|