C19H24FN5O2 — CID 112923261
ethyl 4-[[4-(3-fluoroanilino)-6-methylpyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 112923261) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl 4-[[4-(3-fluoroanilino)-6-methylpyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(3-fluoroanilino)-6-methylpyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112923261 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | ethyl 4-[[4-(3-fluoroanilino)-6-methylpyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nc(C)cc(Nc3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C19H24FN5O2/c1-3-27-19(26)25-9-7-15(8-10-25)23-18-21-13(2)11-17(24-18)22-16-6-4-5-14(20)12-16/h4-6,11-12,15H,3,7-10H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | LHSKDDXNJDZMBT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |