C20H25N5O4 — CID 113194298
4-[[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-6-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113194298) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-6-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-6-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113194298 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-[[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-6-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCOC(=O)N1CCC(Nc2nc(C)cc(Nc3ccc(C(=O)O)cc3)n2)CC1 |
| InChI | InChI=1S/C20H25N5O4/c1-3-29-20(28)25-10-8-16(9-11-25)23-19-21-13(2)12-17(24-19)22-15-6-4-14(5-7-15)18(26)27/h4-7,12,16H,3,8-11H2,1-2H3,(H,26,27)(H2,21,22,23,24) |
| InChIKey | SSUSAHZIHRFFJT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |