C22H40O5Si — CID 11292847
diethyl (3E)-3-[5-[tert-butyl(dimethyl)silyl]oxypentylidene]-4-methylidenehexanedioate (PubChem CID 11292847) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is diethyl (3E)-3-[5-[tert-butyl(dimethyl)silyl]oxypentylidene]-4-methylidenehexanedioate.
| Compound Name | diethyl (3E)-3-[5-[tert-butyl(dimethyl)silyl]oxypentylidene]-4-methylidenehexanedioate |
|---|---|
| PubChem CID | 11292847 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | diethyl (3E)-3-[5-[tert-butyl(dimethyl)silyl]oxypentylidene]-4-methylidenehexanedioate |
| SMILES | C=C(CC(=O)OCC)/C(=C/CCCCO[Si](C)(C)C(C)(C)C)CC(=O)OCC |
| InChI | InChI=1S/C22H40O5Si/c1-9-25-20(23)16-18(3)19(17-21(24)26-10-2)14-12-11-13-15-27-28(7,8)22(4,5)6/h14H,3,9-13,15-17H2,1-2,4-8H3/b19-14+ |
| InChIKey | PFYVLIDSNRBWSZ-XMHGGMMESA-N |
| XLogP | 5.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|