C17H29F3O4SSi — CID 11292907
[(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl] trifluoromethanesulfonate (PubChem CID 11292907) has the molecular formula C17H29F3O4SSi and a molecular weight of 414.56 g/mol. Its IUPAC name is [(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11292907 |
| Molecular Formula | C17H29F3O4SSi |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]2(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]12 |
| InChI | InChI=1S/C17H29F3O4SSi/c1-15(2,3)26(5,6)24-13-8-7-11-16(4)12(13)9-10-14(16)23-25(21,22)17(18,19)20/h10,12-13H,7-9,11H2,1-6H3/t12-,13-,16-/m0/s1 |
| InChIKey | CTRHYFOVBYKADF-XEZPLFJOSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|