C25H46F2O3SSi — CID 10719943
[(3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5,5-difluoropentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane (PubChem CID 10719943) has the molecular formula C25H46F2O3SSi and a molecular weight of 492.79 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5,5-difluoropentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5,5-difluoropentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10719943 |
| Molecular Formula | C25H46F2O3SSi |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | [(3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5,5-difluoropentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CCC(F)(F)S(=O)(=O)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H46F2O3SSi/c1-9-32(10-2,11-3)30-22-13-12-17-24(8)20(14-15-21(22)24)19(4)16-18-25(26,27)31(28,29)23(5,6)7/h14,19,21-22H,9-13,15-18H2,1-8H3/t19-,21+,22+,24-/m1/s1 |
| InChIKey | VAHAUOALOLHEKG-LKFPXLSTSA-N |
| XLogP | 7.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|