C18H30F2O3S — CID 59886640
(3aR,7aS)-1-[(2R)-4-tert-butylsulfonyl-4,4-difluorobutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 59886640) has the molecular formula C18H30F2O3S and a molecular weight of 364.50 g/mol. Its IUPAC name is (3aR,7aS)-1-[(2R)-4-tert-butylsulfonyl-4,4-difluorobutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (3aR,7aS)-1-[(2R)-4-tert-butylsulfonyl-4,4-difluorobutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 59886640 |
| Molecular Formula | C18H30F2O3S |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3aR,7aS)-1-[(2R)-4-tert-butylsulfonyl-4,4-difluorobutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](CC(F)(F)S(=O)(=O)C(C)(C)C)C1=CC[C@H]2C(O)CCC[C@]12C |
| InChI | InChI=1S/C18H30F2O3S/c1-12(11-18(19,20)24(22,23)16(2,3)4)13-8-9-14-15(21)7-6-10-17(13,14)5/h8,12,14-15,21H,6-7,9-11H2,1-5H3/t12-,14+,15?,17-/m1/s1 |
| InChIKey | LQTUTKGEYOWJEK-IMPPXLGYSA-N |
| XLogP | 4.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|