C28H42F2O3S — CID 53329481
(3Z)-3-[(2E)-2-[1-(5-tert-butylsulfonyl-5,5-difluoropentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 53329481) has the molecular formula C28H42F2O3S and a molecular weight of 496.70 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[1-(5-tert-butylsulfonyl-5,5-difluoropentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[1-(5-tert-butylsulfonyl-5,5-difluoropentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 53329481 |
| Molecular Formula | C28H42F2O3S |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (3Z)-3-[(2E)-2-[1-(5-tert-butylsulfonyl-5,5-difluoropentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CCC(O)C/C1=C/C=C1\CCCC2(C)C(C(C)CCC(F)(F)S(=O)(=O)C(C)(C)C)=CCC12 |
| InChI | InChI=1S/C28H42F2O3S/c1-19-9-12-23(31)18-22(19)11-10-21-8-7-16-27(6)24(13-14-25(21)27)20(2)15-17-28(29,30)34(32,33)26(3,4)5/h10-11,13,20,23,25,31H,1,7-9,12,14-18H2,2-6H3/b21-10+,22-11- |
| InChIKey | QDWSTLDECDLSRR-STRHEEPSSA-N |
| XLogP | 7.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|