C21H22N6O3S — CID 11293538
methyl (1S,5R)-6-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N,6-dicyano-3-azabicyclo[3.1.0]hexane-3-carboximidothioate (PubChem CID 11293538) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is methyl (1S,5R)-6-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N,6-dicyano-3-azabicyclo[3.1.0]hexane-3-carboximidothioate.
| Compound Name | methyl (1S,5R)-6-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N,6-dicyano-3-azabicyclo[3.1.0]hexane-3-carboximidothioate |
|---|---|
| PubChem CID | 11293538 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | methyl (1S,5R)-6-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N,6-dicyano-3-azabicyclo[3.1.0]hexane-3-carboximidothioate |
| SMILES | CS/C(=N\C#N)N1C[C@@H]2[C@H](C1)C2(C#N)c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1 |
| InChI | InChI=1S/C21H22N6O3S/c1-13(28)24-7-16-8-27(20(29)30-16)15-5-3-14(4-6-15)21(11-22)17-9-26(10-18(17)21)19(31-2)25-12-23/h3-6,16-18H,7-10H2,1-2H3,(H,24,28)/b25-19-/t16-,17-,18+,21?/m0/s1 |
| InChIKey | MQXCRMQGZAPEQR-DFXKHTADSA-N |
| XLogP | 1.67 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|