C22H23F3O4S — CID 11293589
2-[2-methyl-4-[3-methyl-2-[[4-(trifluoromethyl)phenoxy]methyl]but-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 11293589) has the molecular formula C22H23F3O4S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-[2-methyl-4-[3-methyl-2-[[4-(trifluoromethyl)phenoxy]methyl]but-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[3-methyl-2-[[4-(trifluoromethyl)phenoxy]methyl]but-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11293589 |
| Molecular Formula | C22H23F3O4S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[2-methyl-4-[3-methyl-2-[[4-(trifluoromethyl)phenoxy]methyl]but-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | CC(C)=C(COc1ccc(C(F)(F)F)cc1)CSc1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C22H23F3O4S/c1-14(2)16(11-28-18-6-4-17(5-7-18)22(23,24)25)13-30-19-8-9-20(15(3)10-19)29-12-21(26)27/h4-10H,11-13H2,1-3H3,(H,26,27) |
| InChIKey | LJCRCLUTGXIGOZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|