C12H13Cl2N5 — CID 112938670
5-N-(3,4-dichlorophenyl)-3-N-propyl-1,2,4-triazine-3,5-diamine (PubChem CID 112938670) has the molecular formula C12H13Cl2N5 and a molecular weight of 298.18 g/mol. Its IUPAC name is 5-N-(3,4-dichlorophenyl)-3-N-propyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(3,4-dichlorophenyl)-3-N-propyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112938670 |
| Molecular Formula | C12H13Cl2N5 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-N-(3,4-dichlorophenyl)-3-N-propyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCNc1nncc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H13Cl2N5/c1-2-5-15-12-18-11(7-16-19-12)17-8-3-4-9(13)10(14)6-8/h3-4,6-7H,2,5H2,1H3,(H2,15,17,18,19) |
| InChIKey | LPSSTVPDMFQIAD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |