C17H24N6O — CID 112938778
3-[4-(4-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-1,2,4-triazin-5-amine (PubChem CID 112938778) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-1,2,4-triazin-5-amine.
| Compound Name | 3-[4-(4-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112938778 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)piperazin-1-yl]-N-propan-2-yl-1,2,4-triazin-5-amine |
| SMILES | COc1ccc(N2CCN(c3nncc(NC(C)C)n3)CC2)cc1 |
| InChI | InChI=1S/C17H24N6O/c1-13(2)19-16-12-18-21-17(20-16)23-10-8-22(9-11-23)14-4-6-15(24-3)7-5-14/h4-7,12-13H,8-11H2,1-3H3,(H,19,20,21) |
| InChIKey | RUUYXFDPECJFSL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|