C20H23N5 — CID 112940224
5-N-benzyl-3-N-butyl-5-N-phenyl-1,2,4-triazine-3,5-diamine (PubChem CID 112940224) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-N-benzyl-3-N-butyl-5-N-phenyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-benzyl-3-N-butyl-5-N-phenyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940224 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 5-N-benzyl-3-N-butyl-5-N-phenyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCNc1nncc(N(Cc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C20H23N5/c1-2-3-14-21-20-23-19(15-22-24-20)25(18-12-8-5-9-13-18)16-17-10-6-4-7-11-17/h4-13,15H,2-3,14,16H2,1H3,(H,21,23,24) |
| InChIKey | BYPWKQZANBAQQF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|