C25H26N2 — CID 11294314
(4R,5S)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazole (PubChem CID 11294314) has the molecular formula C25H26N2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (4R,5S)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11294314 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (4R,5S)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(CCCCC2=N[C@H](c3ccccc3)[C@H](c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C25H26N2/c1-4-12-20(13-5-1)14-10-11-19-23-26-24(21-15-6-2-7-16-21)25(27-23)22-17-8-3-9-18-22/h1-9,12-13,15-18,24-25H,10-11,14,19H2,(H,26,27)/t24-,25+ |
| InChIKey | UTILCGQEOQVGJN-PLQXJYEYSA-N |
| XLogP | 5.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|